C17H18N2 — CID 56616744
(1R,16S)-N-methyl-9-azatetracyclo[8.6.1.03,8.013,17]heptadeca-3,5,7,9,11,13-hexaen-16-amine (PubChem CID 56616744) has the molecular formula C17H18N2 and a molecular weight of 250.35 g/mol. Its IUPAC name is (1R,16S)-N-methyl-9-azatetracyclo[8.6.1.03,8.013,17]heptadeca-3,5,7,9,11,13-hexaen-16-amine.
| Compound Name | (1R,16S)-N-methyl-9-azatetracyclo[8.6.1.03,8.013,17]heptadeca-3,5,7,9,11,13-hexaen-16-amine |
|---|---|
| PubChem CID | 56616744 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | (1R,16S)-N-methyl-9-azatetracyclo[8.6.1.03,8.013,17]heptadeca-3,5,7,9,11,13-hexaen-16-amine |
| SMILES | CN[C@H]1CC=C2C=CC3=Nc4ccccc4C[C@@H]1C23 |
| InChI | InChI=1S/C17H18N2/c1-18-15-8-6-11-7-9-16-17(11)13(15)10-12-4-2-3-5-14(12)19-16/h2-7,9,13,15,17-18H,8,10H2,1H3/t13-,15-,17?/m0/s1 |
| InChIKey | VKZHGYUSZGTQFB-JENVPCQVSA-N |
| XLogP | 3.04 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |