C22H25NO7 — CID 56632086
2-formyl-6-methyl-4-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]-2,3,4,5-tetrahydropyridine-3,5-dicarboxylic acid (PubChem CID 56632086) has the molecular formula C22H25NO7 and a molecular weight of 415.44 g/mol. Its IUPAC name is 2-formyl-6-methyl-4-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]-2,3,4,5-tetrahydropyridine-3,5-dicarboxylic acid.
| Compound Name | 2-formyl-6-methyl-4-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]-2,3,4,5-tetrahydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 56632086 |
| Molecular Formula | C22H25NO7 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 2-formyl-6-methyl-4-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]-2,3,4,5-tetrahydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=NC(C=O)C(C(=O)O)C(c2ccccc2C=CC(=O)OC(C)(C)C)C1C(=O)O |
| InChI | InChI=1S/C22H25NO7/c1-12-17(20(26)27)18(19(21(28)29)15(11-24)23-12)14-8-6-5-7-13(14)9-10-16(25)30-22(2,3)4/h5-11,15,17-19H,1-4H3,(H,26,27)(H,28,29) |
| InChIKey | DODLBGMEWHMWFZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|