C24H3F9O11 — CID 56632267
4,8-bis(trifluoromethyl)cyclopenta[f][2]benzofuran-1,3,5,7-tetrone;8-(trifluoromethyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 56632267) has the molecular formula C24H3F9O11 and a molecular weight of 638.26 g/mol. Its IUPAC name is 4,8-bis(trifluoromethyl)cyclopenta[f][2]benzofuran-1,3,5,7-tetrone;8-(trifluoromethyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 4,8-bis(trifluoromethyl)cyclopenta[f][2]benzofuran-1,3,5,7-tetrone;8-(trifluoromethyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 56632267 |
| Molecular Formula | C24H3F9O11 |
| Molecular Weight | 638.26 g/mol |
| Exact Mass | 637.95 |
| IUPAC Name | 4,8-bis(trifluoromethyl)cyclopenta[f][2]benzofuran-1,3,5,7-tetrone;8-(trifluoromethyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | O=C1CC(=O)c2c1c(C(F)(F)F)c1c(c2C(F)(F)F)C(=O)OC1=O.O=c1oc(=O)c2c(C(F)(F)F)c3c(=O)oc(=O)c3cc12 |
| InChI | InChI=1S/C13H2F6O5.C11HF3O6/c14-12(15,16)8-4-2(20)1-3(21)5(4)9(13(17,18)19)7-6(8)10(22)24-11(7)23;12-11(13,14)6-4-2(7(15)19-9(4)17)1-3-5(6)10(18)20-8(3)16/h1H2;1H |
| InChIKey | KCPHEVQZADUGDM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 172.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|