C13H5F3O5 — CID 54529668
4-methyl-8-(trifluoromethyl)cyclopenta[f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 54529668) has the molecular formula C13H5F3O5 and a molecular weight of 298.17 g/mol. Its IUPAC name is 4-methyl-8-(trifluoromethyl)cyclopenta[f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 4-methyl-8-(trifluoromethyl)cyclopenta[f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 54529668 |
| Molecular Formula | C13H5F3O5 |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 4-methyl-8-(trifluoromethyl)cyclopenta[f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | Cc1c2c(c(C(F)(F)F)c3c1C(=O)OC3=O)C(=O)CC2=O |
| InChI | InChI=1S/C13H5F3O5/c1-3-6-4(17)2-5(18)8(6)10(13(14,15)16)9-7(3)11(19)21-12(9)20/h2H2,1H3 |
| InChIKey | YVPLPHFPSFREGH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|