C10F2O6 — CID 91143120
4,5-difluorofuro[3,4-e][2]benzofuran-1,3,6,8-tetrone (PubChem CID 91143120) has the molecular formula C10F2O6 and a molecular weight of 254.10 g/mol. Its IUPAC name is 4,5-difluorofuro[3,4-e][2]benzofuran-1,3,6,8-tetrone.
| Compound Name | 4,5-difluorofuro[3,4-e][2]benzofuran-1,3,6,8-tetrone |
|---|---|
| PubChem CID | 91143120 |
| Molecular Formula | C10F2O6 |
| Molecular Weight | 254.10 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | 4,5-difluorofuro[3,4-e][2]benzofuran-1,3,6,8-tetrone |
| SMILES | O=c1oc(=O)c2c1c(F)c(F)c1c(=O)oc(=O)c12 |
| InChI | InChI=1S/C10F2O6/c11-5-3-1(7(13)17-9(3)15)2-4(6(5)12)10(16)18-8(2)14 |
| InChIKey | UZCGSPCEJDVUGL-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 94.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.10 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |