C3H3F4N — CID 56634863
1,1,3,3-tetrafluoropropan-2-imine (PubChem CID 56634863) has the molecular formula C3H3F4N and a molecular weight of 129.06 g/mol. Its IUPAC name is 1,1,3,3-tetrafluoropropan-2-imine.
| Compound Name | 1,1,3,3-tetrafluoropropan-2-imine |
|---|---|
| PubChem CID | 56634863 |
| Molecular Formula | C3H3F4N |
| Molecular Weight | 129.06 g/mol |
| Exact Mass | 129.02 |
| IUPAC Name | 1,1,3,3-tetrafluoropropan-2-imine |
| SMILES | [H]N=C(C(F)F)C(F)F |
| InChI | InChI=1S/C3H3F4N/c4-2(5)1(8)3(6)7/h2-3,8H |
| InChIKey | YFPLETRCHRRZLN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.06 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|