C15H25N — CID 56636620
1-[2-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)ethenyl]cyclopropan-1-amine (PubChem CID 56636620) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 1-[2-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)ethenyl]cyclopropan-1-amine.
| Compound Name | 1-[2-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)ethenyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 56636620 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 1-[2-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)ethenyl]cyclopropan-1-amine |
| SMILES | CC12CCC(C1)C(C)(C)C2C=CC1(N)CC1 |
| InChI | InChI=1S/C15H25N/c1-13(2)11-4-6-14(3,10-11)12(13)5-7-15(16)8-9-15/h5,7,11-12H,4,6,8-10,16H2,1-3H3 |
| InChIKey | YJWAQBGCOYMTOT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|