C22H26N4O4S — CID 56638196
2-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-4-methyl-[1,3]dioxolo[4,5-g][1,2,4]benzothiadiazin-3-one (PubChem CID 56638196) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is 2-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-4-methyl-[1,3]dioxolo[4,5-g][1,2,4]benzothiadiazin-3-one.
| Compound Name | 2-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-4-methyl-[1,3]dioxolo[4,5-g][1,2,4]benzothiadiazin-3-one |
|---|---|
| PubChem CID | 56638196 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 2-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-4-methyl-[1,3]dioxolo[4,5-g][1,2,4]benzothiadiazin-3-one |
| SMILES | COc1ccccc1N1CCN(CCN2Sc3cc4c(cc3N(C)C2=O)OCO4)CC1 |
| InChI | InChI=1S/C22H26N4O4S/c1-23-17-13-19-20(30-15-29-19)14-21(17)31-26(22(23)27)12-9-24-7-10-25(11-8-24)16-5-3-4-6-18(16)28-2/h3-6,13-14H,7-12,15H2,1-2H3 |
| InChIKey | XNNQEDJWXMSFJQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 57.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|