C25H32N4O4S — CID 56617211
3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1,8,9,10-tetrahydro-[1,4]dioxepino[2,3-f][1,2,4]benzothiadiazin-2-one (PubChem CID 56617211) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is 3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1,8,9,10-tetrahydro-[1,4]dioxepino[2,3-f][1,2,4]benzothiadiazin-2-one.
| Compound Name | 3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1,8,9,10-tetrahydro-[1,4]dioxepino[2,3-f][1,2,4]benzothiadiazin-2-one |
|---|---|
| PubChem CID | 56617211 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-1,8,9,10-tetrahydro-[1,4]dioxepino[2,3-f][1,2,4]benzothiadiazin-2-one |
| SMILES | COc1ccccc1N1CCN(CCCCN2Sc3ccc4c(c3NC2=O)OCCCO4)CC1 |
| InChI | InChI=1S/C25H32N4O4S/c1-31-20-8-3-2-7-19(20)28-15-13-27(14-16-28)11-4-5-12-29-25(30)26-23-22(34-29)10-9-21-24(23)33-18-6-17-32-21/h2-3,7-10H,4-6,11-18H2,1H3,(H,26,30) |
| InChIKey | CGXBABVGCGQQNT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|