C27H28N2O4 — CID 56639630
10-[(3,5-dimethoxyphenyl)methyl]-2-(4-hydroxypiperidin-1-yl)acridin-9-one (PubChem CID 56639630) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 10-[(3,5-dimethoxyphenyl)methyl]-2-(4-hydroxypiperidin-1-yl)acridin-9-one.
| Compound Name | 10-[(3,5-dimethoxyphenyl)methyl]-2-(4-hydroxypiperidin-1-yl)acridin-9-one |
|---|---|
| PubChem CID | 56639630 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 10-[(3,5-dimethoxyphenyl)methyl]-2-(4-hydroxypiperidin-1-yl)acridin-9-one |
| SMILES | COc1cc(Cn2c3ccccc3c(=O)c3cc(N4CCC(O)CC4)ccc32)cc(OC)c1 |
| InChI | InChI=1S/C27H28N2O4/c1-32-21-13-18(14-22(16-21)33-2)17-29-25-6-4-3-5-23(25)27(31)24-15-19(7-8-26(24)29)28-11-9-20(30)10-12-28/h3-8,13-16,20,30H,9-12,17H2,1-2H3 |
| InChIKey | AMBNHDCJKLNMPH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|