C28H32N4O4 — CID 52940905
2,6-diamino-N-[10-[(3,5-dimethoxyphenyl)methyl]-9-oxoacridin-2-yl]hexanamide (PubChem CID 52940905) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is 2,6-diamino-N-[10-[(3,5-dimethoxyphenyl)methyl]-9-oxoacridin-2-yl]hexanamide.
| Compound Name | 2,6-diamino-N-[10-[(3,5-dimethoxyphenyl)methyl]-9-oxoacridin-2-yl]hexanamide |
|---|---|
| PubChem CID | 52940905 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 2,6-diamino-N-[10-[(3,5-dimethoxyphenyl)methyl]-9-oxoacridin-2-yl]hexanamide |
| SMILES | COc1cc(Cn2c3ccccc3c(=O)c3cc(NC(=O)C(N)CCCCN)ccc32)cc(OC)c1 |
| InChI | InChI=1S/C28H32N4O4/c1-35-20-13-18(14-21(16-20)36-2)17-32-25-9-4-3-7-22(25)27(33)23-15-19(10-11-26(23)32)31-28(34)24(30)8-5-6-12-29/h3-4,7,9-11,13-16,24H,5-6,8,12,17,29-30H2,1-2H3,(H,31,34) |
| InChIKey | SZAFSJJQCBGVLU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|