C26H26N2O3 — CID 56639627
10-[(3,5-dimethoxyphenyl)methyl]-2-pyrrolidin-1-ylacridin-9-one (PubChem CID 56639627) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 10-[(3,5-dimethoxyphenyl)methyl]-2-pyrrolidin-1-ylacridin-9-one.
| Compound Name | 10-[(3,5-dimethoxyphenyl)methyl]-2-pyrrolidin-1-ylacridin-9-one |
|---|---|
| PubChem CID | 56639627 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 10-[(3,5-dimethoxyphenyl)methyl]-2-pyrrolidin-1-ylacridin-9-one |
| SMILES | COc1cc(Cn2c3ccccc3c(=O)c3cc(N4CCCC4)ccc32)cc(OC)c1 |
| InChI | InChI=1S/C26H26N2O3/c1-30-20-13-18(14-21(16-20)31-2)17-28-24-8-4-3-7-22(24)26(29)23-15-19(9-10-25(23)28)27-11-5-6-12-27/h3-4,7-10,13-16H,5-6,11-12,17H2,1-2H3 |
| InChIKey | DMMCJJQGQPSILD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|