C33H38N4O3 — CID 56640420
N-[[9-benzyl-1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 56640420) has the molecular formula C33H38N4O3 and a molecular weight of 538.69 g/mol. Its IUPAC name is N-[[9-benzyl-1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[[9-benzyl-1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 56640420 |
| Molecular Formula | C33H38N4O3 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | N-[[9-benzyl-1-(3,4,5-trimethoxyphenyl)pyrido[3,4-b]indol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | COc1cc(-c2nc(CNCCCN(C)C)cc3c4ccccc4n(Cc4ccccc4)c23)cc(OC)c1OC |
| InChI | InChI=1S/C33H38N4O3/c1-36(2)17-11-16-34-21-25-20-27-26-14-9-10-15-28(26)37(22-23-12-7-6-8-13-23)32(27)31(35-25)24-18-29(38-3)33(40-5)30(19-24)39-4/h6-10,12-15,18-20,34H,11,16-17,21-22H2,1-5H3 |
| InChIKey | KKSVOCLUJJBBLW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 60.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|