C26H20O9 — CID 56641636
5,7-dihydroxy-3-[(E)-4-(4-hydroxy-3-methoxyphenyl)-2-oxobut-3-enoxy]-2-(4-hydroxyphenyl)chromen-4-one (PubChem CID 56641636) has the molecular formula C26H20O9 and a molecular weight of 476.44 g/mol. Its IUPAC name is 5,7-dihydroxy-3-[(E)-4-(4-hydroxy-3-methoxyphenyl)-2-oxobut-3-enoxy]-2-(4-hydroxyphenyl)chromen-4-one.
| Compound Name | 5,7-dihydroxy-3-[(E)-4-(4-hydroxy-3-methoxyphenyl)-2-oxobut-3-enoxy]-2-(4-hydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 56641636 |
| Molecular Formula | C26H20O9 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 5,7-dihydroxy-3-[(E)-4-(4-hydroxy-3-methoxyphenyl)-2-oxobut-3-enoxy]-2-(4-hydroxyphenyl)chromen-4-one |
| SMILES | COc1cc(/C=C/C(=O)COc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)ccc1O |
| InChI | InChI=1S/C26H20O9/c1-33-21-10-14(3-9-19(21)30)2-6-17(28)13-34-26-24(32)23-20(31)11-18(29)12-22(23)35-25(26)15-4-7-16(27)8-5-15/h2-12,27,29-31H,13H2,1H3/b6-2+ |
| InChIKey | KMNCYJFCTFQDKF-QHHAFSJGSA-N |
| XLogP | 3.95 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|