C23H36O5 — CID 56647043
methyl 2-[(2R,3R,4R)-4-[(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-2-acetyl-5-hydroxyoxolan-3-yl]acetate (PubChem CID 56647043) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4R)-4-[(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-2-acetyl-5-hydroxyoxolan-3-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,4R)-4-[(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-2-acetyl-5-hydroxyoxolan-3-yl]acetate |
|---|---|
| PubChem CID | 56647043 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | methyl 2-[(2R,3R,4R)-4-[(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-2-acetyl-5-hydroxyoxolan-3-yl]acetate |
| SMILES | C=C1CCCC(C)(C)[C@@H]2CC[C@@](C)([C@@H]3C(O)O[C@@H](C(C)=O)[C@@H]3CC(=O)OC)[C@H]12 |
| InChI | InChI=1S/C23H36O5/c1-13-8-7-10-22(3,4)16-9-11-23(5,18(13)16)19-15(12-17(25)27-6)20(14(2)24)28-21(19)26/h15-16,18-21,26H,1,7-12H2,2-6H3/t15-,16-,18-,19+,20+,21?,23-/m1/s1 |
| InChIKey | SCLCGJHFMHNBIV-AVAGIWSOSA-N |
| XLogP | 3.89 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|