C22H33FO4 — CID 56647045
2-[(2R,3R,4R)-4-[(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-2-acetyl-5-fluorooxolan-3-yl]acetic acid (PubChem CID 56647045) has the molecular formula C22H33FO4 and a molecular weight of 380.50 g/mol. Its IUPAC name is 2-[(2R,3R,4R)-4-[(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-2-acetyl-5-fluorooxolan-3-yl]acetic acid.
| Compound Name | 2-[(2R,3R,4R)-4-[(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-2-acetyl-5-fluorooxolan-3-yl]acetic acid |
|---|---|
| PubChem CID | 56647045 |
| Molecular Formula | C22H33FO4 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 2-[(2R,3R,4R)-4-[(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-2-acetyl-5-fluorooxolan-3-yl]acetic acid |
| SMILES | C=C1CCCC(C)(C)[C@@H]2CC[C@@](C)([C@@H]3C(F)O[C@@H](C(C)=O)[C@@H]3CC(=O)O)[C@H]12 |
| InChI | InChI=1S/C22H33FO4/c1-12-7-6-9-21(3,4)15-8-10-22(5,17(12)15)18-14(11-16(25)26)19(13(2)24)27-20(18)23/h14-15,17-20H,1,6-11H2,2-5H3,(H,25,26)/t14-,15-,17-,18+,19+,20?,22-/m1/s1 |
| InChIKey | BGYUJFHDGMRIDF-WWLMMNKTSA-N |
| XLogP | 4.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|