C22H32O4 — CID 56647046
(1S,5R,6R,8R)-8-[(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-6-acetyl-2,7-dioxabicyclo[3.2.1]octan-3-one (PubChem CID 56647046) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (1S,5R,6R,8R)-8-[(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-6-acetyl-2,7-dioxabicyclo[3.2.1]octan-3-one.
| Compound Name | (1S,5R,6R,8R)-8-[(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-6-acetyl-2,7-dioxabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 56647046 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (1S,5R,6R,8R)-8-[(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-6-acetyl-2,7-dioxabicyclo[3.2.1]octan-3-one |
| SMILES | C=C1CCCC(C)(C)[C@@H]2CC[C@@](C)([C@@H]3[C@@H]4OC(=O)C[C@H]3[C@H](C(C)=O)O4)[C@H]12 |
| InChI | InChI=1S/C22H32O4/c1-12-7-6-9-21(3,4)15-8-10-22(5,17(12)15)18-14-11-16(24)25-20(18)26-19(14)13(2)23/h14-15,17-20H,1,6-11H2,2-5H3/t14-,15-,17-,18+,19+,20-,22-/m1/s1 |
| InChIKey | IDHGDGGRJSCFJE-GJBPMJSVSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|