C23H37NO2S — CID 56649285
[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl] N-(2-sulfanylethyl)carbamate (PubChem CID 56649285) has the molecular formula C23H37NO2S and a molecular weight of 391.62 g/mol. Its IUPAC name is [(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl] N-(2-sulfanylethyl)carbamate.
| Compound Name | [(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl] N-(2-sulfanylethyl)carbamate |
|---|---|
| PubChem CID | 56649285 |
| Molecular Formula | C23H37NO2S |
| Molecular Weight | 391.62 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | [(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl] N-(2-sulfanylethyl)carbamate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(=O)NCCS |
| InChI | InChI=1S/C23H37NO2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21-26-23(25)24-20-22-27/h3-4,6-7,9-10,12-13,15-16,27H,2,5,8,11,14,17-22H2,1H3,(H,24,25)/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | LBCKSQPZSIEYQT-JLNKQSITSA-N |
| XLogP | 6.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.62 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|