C10H12O3 — CID 56649934
(E)-2-methyl-4-[(3R)-4-methylidene-5-oxooxolan-3-yl]but-2-enal (PubChem CID 56649934) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (E)-2-methyl-4-[(3R)-4-methylidene-5-oxooxolan-3-yl]but-2-enal.
| Compound Name | (E)-2-methyl-4-[(3R)-4-methylidene-5-oxooxolan-3-yl]but-2-enal |
|---|---|
| PubChem CID | 56649934 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (E)-2-methyl-4-[(3R)-4-methylidene-5-oxooxolan-3-yl]but-2-enal |
| SMILES | C=C1C(=O)OC[C@@H]1C/C=C(\C)C=O |
| InChI | InChI=1S/C10H12O3/c1-7(5-11)3-4-9-6-13-10(12)8(9)2/h3,5,9H,2,4,6H2,1H3/b7-3+/t9-/m0/s1 |
| InChIKey | ARQXVBHZLIMZFL-HMVTZJNGSA-N |
| XLogP | 1.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|