About N-[3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]phenyl]-4-cyanobenzenesulfonamide
N-[3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]phenyl]-4-cyanobenzenesulfonamide (PubChem CID 56650264) has the molecular formula C21H18N4O2S
and a molecular weight of 390.47 g/mol. Its IUPAC name is N-[3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]phenyl]-4-cyanobenzenesulfonamide.
Molecular Properties
| Compound Name | N-[3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]phenyl]-4-cyanobenzenesulfonamide |
| PubChem CID | 56650264 |
| Molecular Formula | C21H18N4O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]phenyl]-4-cyanobenzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)Nc2cccc(-c3ccc([C@H]4C[C@@H]4N)cn3)c2)cc1 |
| InChI | InChI=1S/C21H18N4O2S/c22-12-14-4-7-18(8-5-14)28(26,27)25-17-3-1-2-15(10-17)21-9-6-16(13-24-21)19-11-20(19)23/h1-10,13,19-20,25H,11,23H2/t19-,20+/m1/s1 |
| InChIKey | ZWIYKBPLUJMBJN-UXHICEINSA-N |
| XLogP | 3.24 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]phenyl]-4-cyanobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]phenyl]-4-cyanobenzenesulfonamide?
The IUPAC name of N-[3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]phenyl]-4-cyanobenzenesulfonamide (CID 56650264) is N-[3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]phenyl]-4-cyanobenzenesulfonamide.
What is the SMILES notation for N-[3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]phenyl]-4-cyanobenzenesulfonamide?
The canonical SMILES for N-[3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]phenyl]-4-cyanobenzenesulfonamide is N#Cc1ccc(S(=O)(=O)Nc2cccc(-c3ccc([C@H]4C[C@@H]4N)cn3)c2)cc1.
What is the InChIKey of N-[3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]phenyl]-4-cyanobenzenesulfonamide?
The InChIKey is ZWIYKBPLUJMBJN-UXHICEINSA-N. The full InChI is InChI=1S/C21H18N4O2S/c22-12-14-4-7-18(8-5-14)28(26,27)25-17-3-1-2-15(10-17)21-9-6-16(13-24-21)19-11-20(19)23/h1-10,13,19-20,25H,11,23H2/t19-,20+/m1/s1.
What are the key properties of N-[3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]phenyl]-4-cyanobenzenesulfonamide?
N-[3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]phenyl]-4-cyanobenzenesulfonamide has a molecular weight of 390.47 g/mol, XLogP of 3.24, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]phenyl]-4-cyanobenzenesulfonamide is sourced from PubChem (CID 56650264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).