C33H49NO5Si — CID 56650480
[(E)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]non-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 56650480) has the molecular formula C33H49NO5Si and a molecular weight of 567.84 g/mol. Its IUPAC name is [(E)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]non-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [(E)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]non-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 56650480 |
| Molecular Formula | C33H49NO5Si |
| Molecular Weight | 567.84 g/mol |
| Exact Mass | 567.34 |
| IUPAC Name | [(E)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]non-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CCCCC/C=C(\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)OC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H49NO5Si/c1-9-10-11-14-19-27(26(2)38-30(35)24-34-31(36)39-32(3,4)5)25-37-40(33(6,7)8,28-20-15-12-16-21-28)29-22-17-13-18-23-29/h12-13,15-23,26H,9-11,14,24-25H2,1-8H3,(H,34,36)/b27-19+ |
| InChIKey | RACXYESPQULZFC-ZXVVBBHZSA-N |
| XLogP | 6.53 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.84 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|