C20H22FN5O — CID 56651606
2-ethyl-4-[[(1S)-1-(3-fluorophenyl)-2-(methylamino)ethyl]amino]quinazoline-8-carboxamide (PubChem CID 56651606) has the molecular formula C20H22FN5O and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-ethyl-4-[[(1S)-1-(3-fluorophenyl)-2-(methylamino)ethyl]amino]quinazoline-8-carboxamide.
| Compound Name | 2-ethyl-4-[[(1S)-1-(3-fluorophenyl)-2-(methylamino)ethyl]amino]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 56651606 |
| Molecular Formula | C20H22FN5O |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 2-ethyl-4-[[(1S)-1-(3-fluorophenyl)-2-(methylamino)ethyl]amino]quinazoline-8-carboxamide |
| SMILES | CCc1nc(N[C@H](CNC)c2cccc(F)c2)c2cccc(C(N)=O)c2n1 |
| InChI | InChI=1S/C20H22FN5O/c1-3-17-25-18-14(19(22)27)8-5-9-15(18)20(26-17)24-16(11-23-2)12-6-4-7-13(21)10-12/h4-10,16,23H,3,11H2,1-2H3,(H2,22,27)(H,24,25,26)/t16-/m1/s1 |
| InChIKey | FLGUGRAWIWHCJF-MRXNPFEDSA-N |
| XLogP | 2.80 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |