C24H24N2O3S — CID 56651875
1'-benzyl-1-(4-nitrophenyl)spiro[6,7-dihydrothieno[3,4-c]pyran-4,4'-piperidine] (PubChem CID 56651875) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is 1'-benzyl-1-(4-nitrophenyl)spiro[6,7-dihydrothieno[3,4-c]pyran-4,4'-piperidine].
| Compound Name | 1'-benzyl-1-(4-nitrophenyl)spiro[6,7-dihydrothieno[3,4-c]pyran-4,4'-piperidine] |
|---|---|
| PubChem CID | 56651875 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 1'-benzyl-1-(4-nitrophenyl)spiro[6,7-dihydrothieno[3,4-c]pyran-4,4'-piperidine] |
| SMILES | O=[N+]([O-])c1ccc(-c2scc3c2CCOC32CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H24N2O3S/c27-26(28)20-8-6-19(7-9-20)23-21-10-15-29-24(22(21)17-30-23)11-13-25(14-12-24)16-18-4-2-1-3-5-18/h1-9,17H,10-16H2 |
| InChIKey | CBLJDEYDWYIDTM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|