C16H15F3N2O2 — CID 56653029
pyrimidin-2-yl-[1-[4-(trifluoromethoxy)phenyl]cyclobutyl]methanol (PubChem CID 56653029) has the molecular formula C16H15F3N2O2 and a molecular weight of 324.30 g/mol. Its IUPAC name is pyrimidin-2-yl-[1-[4-(trifluoromethoxy)phenyl]cyclobutyl]methanol.
| Compound Name | pyrimidin-2-yl-[1-[4-(trifluoromethoxy)phenyl]cyclobutyl]methanol |
|---|---|
| PubChem CID | 56653029 |
| Molecular Formula | C16H15F3N2O2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | pyrimidin-2-yl-[1-[4-(trifluoromethoxy)phenyl]cyclobutyl]methanol |
| SMILES | OC(c1ncccn1)C1(c2ccc(OC(F)(F)F)cc2)CCC1 |
| InChI | InChI=1S/C16H15F3N2O2/c17-16(18,19)23-12-5-3-11(4-6-12)15(7-1-8-15)13(22)14-20-9-2-10-21-14/h2-6,9-10,13,22H,1,7-8H2 |
| InChIKey | KWGXZNZLHFMARC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |