C18H18F3NO2 — CID 66749821
2-pyridin-2-yl-2-[1-[4-(trifluoromethoxy)phenyl]cyclobutyl]ethanol (PubChem CID 66749821) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-pyridin-2-yl-2-[1-[4-(trifluoromethoxy)phenyl]cyclobutyl]ethanol.
| Compound Name | 2-pyridin-2-yl-2-[1-[4-(trifluoromethoxy)phenyl]cyclobutyl]ethanol |
|---|---|
| PubChem CID | 66749821 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-pyridin-2-yl-2-[1-[4-(trifluoromethoxy)phenyl]cyclobutyl]ethanol |
| SMILES | OCC(c1ccccn1)C1(c2ccc(OC(F)(F)F)cc2)CCC1 |
| InChI | InChI=1S/C18H18F3NO2/c19-18(20,21)24-14-7-5-13(6-8-14)17(9-3-10-17)15(12-23)16-4-1-2-11-22-16/h1-2,4-8,11,15,23H,3,9-10,12H2 |
| InChIKey | TWJYZQFXSYVBNP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |