C19H21F3N2O2 — CID 71555149
[1-methyl-4-[2-(trifluoromethoxy)phenyl]piperidin-4-yl]-pyridin-2-ylmethanol (PubChem CID 71555149) has the molecular formula C19H21F3N2O2 and a molecular weight of 366.38 g/mol. Its IUPAC name is [1-methyl-4-[2-(trifluoromethoxy)phenyl]piperidin-4-yl]-pyridin-2-ylmethanol.
| Compound Name | [1-methyl-4-[2-(trifluoromethoxy)phenyl]piperidin-4-yl]-pyridin-2-ylmethanol |
|---|---|
| PubChem CID | 71555149 |
| Molecular Formula | C19H21F3N2O2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | [1-methyl-4-[2-(trifluoromethoxy)phenyl]piperidin-4-yl]-pyridin-2-ylmethanol |
| SMILES | CN1CCC(c2ccccc2OC(F)(F)F)(C(O)c2ccccn2)CC1 |
| InChI | InChI=1S/C19H21F3N2O2/c1-24-12-9-18(10-13-24,17(25)15-7-4-5-11-23-15)14-6-2-3-8-16(14)26-19(20,21)22/h2-8,11,17,25H,9-10,12-13H2,1H3 |
| InChIKey | JGSBDZKTLUEICY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |