C14H19N7O6 — CID 56654214
N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 56654214) has the molecular formula C14H19N7O6 and a molecular weight of 381.35 g/mol. Its IUPAC name is N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-4-nitro-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 56654214 |
| Molecular Formula | C14H19N7O6 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C14H19N7O6/c15-20-17-4-6-25-8-10-26-9-7-24-5-3-16-11-1-2-12(21(22)23)14-13(11)18-27-19-14/h1-2,16H,3-10H2 |
| InChIKey | ZTJNWVOHDVHTNZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 170.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|