C30H36N6O4 — CID 56663377
(3S,4S)-1-[(2S,3R)-2-amino-3-hydroxybutanoyl]-3-N,4-N-bis[2-(1H-indol-3-yl)ethyl]pyrrolidine-3,4-dicarboxamide (PubChem CID 56663377) has the molecular formula C30H36N6O4 and a molecular weight of 544.66 g/mol. Its IUPAC name is (3S,4S)-1-[(2S,3R)-2-amino-3-hydroxybutanoyl]-3-N,4-N-bis[2-(1H-indol-3-yl)ethyl]pyrrolidine-3,4-dicarboxamide.
| Compound Name | (3S,4S)-1-[(2S,3R)-2-amino-3-hydroxybutanoyl]-3-N,4-N-bis[2-(1H-indol-3-yl)ethyl]pyrrolidine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 56663377 |
| Molecular Formula | C30H36N6O4 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | (3S,4S)-1-[(2S,3R)-2-amino-3-hydroxybutanoyl]-3-N,4-N-bis[2-(1H-indol-3-yl)ethyl]pyrrolidine-3,4-dicarboxamide |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N1C[C@@H](C(=O)NCCc2c[nH]c3ccccc23)[C@H](C(=O)NCCc2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C30H36N6O4/c1-18(37)27(31)30(40)36-16-23(28(38)32-12-10-19-14-34-25-8-4-2-6-21(19)25)24(17-36)29(39)33-13-11-20-15-35-26-9-5-3-7-22(20)26/h2-9,14-15,18,23-24,27,34-35,37H,10-13,16-17,31H2,1H3,(H,32,38)(H,33,39)/t18-,23-,24-,27+/m1/s1 |
| InChIKey | NGACGUDUWFGZLO-SMQQHAMCSA-N |
| XLogP | 1.45 |
| TPSA | 156.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |