C16H21N3O2 — CID 66267223
N-[2-(1H-indol-3-yl)ethyl]-4-(methylamino)oxolane-3-carboxamide (PubChem CID 66267223) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-4-(methylamino)oxolane-3-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-4-(methylamino)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66267223 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-4-(methylamino)oxolane-3-carboxamide |
| SMILES | CNC1COCC1C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H21N3O2/c1-17-15-10-21-9-13(15)16(20)18-7-6-11-8-19-14-5-3-2-4-12(11)14/h2-5,8,13,15,17,19H,6-7,9-10H2,1H3,(H,18,20) |
| InChIKey | PLKDSKQCJYJTKV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |