C22H29N3O5 — CID 56668717
4-[(5R,6S,9S,13S)-7-(3-nitrobenzoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid (PubChem CID 56668717) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is 4-[(5R,6S,9S,13S)-7-(3-nitrobenzoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid.
| Compound Name | 4-[(5R,6S,9S,13S)-7-(3-nitrobenzoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid |
|---|---|
| PubChem CID | 56668717 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 4-[(5R,6S,9S,13S)-7-(3-nitrobenzoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid |
| SMILES | O=C(O)CCC[C@H]1[C@H]2CCCN3CCC[C@@H](CN1C(=O)c1cccc([N+](=O)[O-])c1)[C@@H]23 |
| InChI | InChI=1S/C22H29N3O5/c26-20(27)10-2-9-19-18-8-4-12-23-11-3-6-16(21(18)23)14-24(19)22(28)15-5-1-7-17(13-15)25(29)30/h1,5,7,13,16,18-19,21H,2-4,6,8-12,14H2,(H,26,27)/t16-,18+,19-,21-/m0/s1 |
| InChIKey | BWAFRCKQFHTKLV-KRQVXIAISA-N |
| XLogP | 3.16 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|