C19H24BrN3O — CID 56675370
(2S)-1-cycloheptyl-2-phenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide (PubChem CID 56675370) has the molecular formula C19H24BrN3O and a molecular weight of 390.33 g/mol. Its IUPAC name is (2S)-1-cycloheptyl-2-phenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide.
| Compound Name | (2S)-1-cycloheptyl-2-phenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide |
|---|---|
| PubChem CID | 56675370 |
| Molecular Formula | C19H24BrN3O |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | (2S)-1-cycloheptyl-2-phenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide |
| SMILES | O[C@@]1(c2ccccc2)C[n+]2cccnc2N1C1CCCCCC1.[Br-] |
| InChI | InChI=1S/C19H24N3O.BrH/c23-19(16-9-4-3-5-10-16)15-21-14-8-13-20-18(21)22(19)17-11-6-1-2-7-12-17;/h3-5,8-10,13-14,17,23H,1-2,6-7,11-12,15H2;1H/q+1;/p-1/t19-;/m1./s1 |
| InChIKey | VJDROOVKIPGWHG-FSRHSHDFSA-M |
| XLogP | -0.24 |
| TPSA | 40.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|