C18H21N3O3 — CID 56676187
(NZ)-N-[[6-methyl-2-(4-methylphenoxy)-3-pyridinyl]-morpholin-4-ylmethylidene]hydroxylamine (PubChem CID 56676187) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is (NZ)-N-[[6-methyl-2-(4-methylphenoxy)-3-pyridinyl]-morpholin-4-ylmethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[6-methyl-2-(4-methylphenoxy)-3-pyridinyl]-morpholin-4-ylmethylidene]hydroxylamine |
|---|---|
| PubChem CID | 56676187 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (NZ)-N-[[6-methyl-2-(4-methylphenoxy)-3-pyridinyl]-morpholin-4-ylmethylidene]hydroxylamine |
| SMILES | Cc1ccc(Oc2nc(C)ccc2/C(=N/O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H21N3O3/c1-13-3-6-15(7-4-13)24-18-16(8-5-14(2)19-18)17(20-22)21-9-11-23-12-10-21/h3-8,22H,9-12H2,1-2H3/b20-17- |
| InChIKey | IDFAEPKFCCMSQE-JZJYNLBNSA-N |
| XLogP | 2.96 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|