C16H11BrN4O3 — CID 56676407
4-[[5-(6-bromo-3-pyridinyl)-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]amino]benzonitrile (PubChem CID 56676407) has the molecular formula C16H11BrN4O3 and a molecular weight of 387.19 g/mol. Its IUPAC name is 4-[[5-(6-bromo-3-pyridinyl)-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]amino]benzonitrile.
| Compound Name | 4-[[5-(6-bromo-3-pyridinyl)-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 56676407 |
| Molecular Formula | C16H11BrN4O3 |
| Molecular Weight | 387.19 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | 4-[[5-(6-bromo-3-pyridinyl)-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]amino]benzonitrile |
| SMILES | CC1(c2ccc(Br)nc2)OC(=O)N(Nc2ccc(C#N)cc2)C1=O |
| InChI | InChI=1S/C16H11BrN4O3/c1-16(11-4-7-13(17)19-9-11)14(22)21(15(23)24-16)20-12-5-2-10(8-18)3-6-12/h2-7,9,20H,1H3 |
| InChIKey | NKFFLYWIAHIWLC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.19 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|