C30H27F2N7O5 — CID 56680311
(E)-N-[4-[1-[(2S)-2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-5-oxo-1,2,4-triazol-4-yl]phenyl]-3-(2,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 56680311) has the molecular formula C30H27F2N7O5 and a molecular weight of 603.59 g/mol. Its IUPAC name is (E)-N-[4-[1-[(2S)-2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-5-oxo-1,2,4-triazol-4-yl]phenyl]-3-(2,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[1-[(2S)-2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-5-oxo-1,2,4-triazol-4-yl]phenyl]-3-(2,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 56680311 |
| Molecular Formula | C30H27F2N7O5 |
| Molecular Weight | 603.59 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | (E)-N-[4-[1-[(2S)-2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-5-oxo-1,2,4-triazol-4-yl]phenyl]-3-(2,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)Nc2ccc(-n3cnn(C[C@@](O)(Cn4cncn4)c4ccc(F)cc4F)c3=O)cc2)c1 |
| InChI | InChI=1S/C30H27F2N7O5/c1-43-24-9-11-27(44-2)20(13-24)3-12-28(40)36-22-5-7-23(8-6-22)38-19-35-39(29(38)41)16-30(42,15-37-18-33-17-34-37)25-10-4-21(31)14-26(25)32/h3-14,17-19,42H,15-16H2,1-2H3,(H,36,40)/b12-3+/t30-/m0/s1 |
| InChIKey | ALDREGIOXGQGRA-SHZPJRIYSA-N |
| XLogP | 3.16 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|