C19H21NO5 — CID 56682390
(8R,9S,13S,14S)-3-hydroxy-13-methyl-2-nitro-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-4-carbaldehyde (PubChem CID 56682390) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-hydroxy-13-methyl-2-nitro-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-4-carbaldehyde.
| Compound Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-2-nitro-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-4-carbaldehyde |
|---|---|
| PubChem CID | 56682390 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-2-nitro-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-4-carbaldehyde |
| SMILES | C[C@]12CC[C@@H]3c4cc([N+](=O)[O-])c(O)c(C=O)c4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C19H21NO5/c1-19-7-6-11-12(15(19)4-5-17(19)22)3-2-10-13(11)8-16(20(24)25)18(23)14(10)9-21/h8-9,11-12,15,23H,2-7H2,1H3/t11-,12+,15-,19-/m0/s1 |
| InChIKey | PHZLNYHJRCTTOZ-RHQBZFHZSA-N |
| XLogP | 3.54 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|