About S-cyano (E)-3-(furan-2-yl)prop-2-enethioate
S-cyano (E)-3-(furan-2-yl)prop-2-enethioate (PubChem CID 56688094) has the molecular formula C8H5NO2S
and a molecular weight of 179.20 g/mol. Its IUPAC name is S-cyano (E)-3-(furan-2-yl)prop-2-enethioate.
Molecular Properties
| Compound Name | S-cyano (E)-3-(furan-2-yl)prop-2-enethioate |
| PubChem CID | 56688094 |
| Molecular Formula | C8H5NO2S |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.00 |
| IUPAC Name | S-cyano (E)-3-(furan-2-yl)prop-2-enethioate |
| SMILES | N#CSC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C8H5NO2S/c9-6-12-8(10)4-3-7-2-1-5-11-7/h1-5H/b4-3+ |
| InChIKey | GQEOSNRXDQSSFW-ONEGZZNKSA-N |
| XLogP | 2.03 |
| TPSA | 54.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-cyano (E)-3-(furan-2-yl)prop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-cyano (E)-3-(furan-2-yl)prop-2-enethioate?
The IUPAC name of S-cyano (E)-3-(furan-2-yl)prop-2-enethioate (CID 56688094) is S-cyano (E)-3-(furan-2-yl)prop-2-enethioate.
What is the SMILES notation for S-cyano (E)-3-(furan-2-yl)prop-2-enethioate?
The canonical SMILES for S-cyano (E)-3-(furan-2-yl)prop-2-enethioate is N#CSC(=O)/C=C/c1ccco1.
What is the InChIKey of S-cyano (E)-3-(furan-2-yl)prop-2-enethioate?
The InChIKey is GQEOSNRXDQSSFW-ONEGZZNKSA-N. The full InChI is InChI=1S/C8H5NO2S/c9-6-12-8(10)4-3-7-2-1-5-11-7/h1-5H/b4-3+.
What are the key properties of S-cyano (E)-3-(furan-2-yl)prop-2-enethioate?
S-cyano (E)-3-(furan-2-yl)prop-2-enethioate has a molecular weight of 179.20 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-cyano (E)-3-(furan-2-yl)prop-2-enethioate is sourced from PubChem (CID 56688094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).