C12H16N6S — CID 56689227
5-[6-(azepan-1-yl)pyrazin-2-yl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 56689227) has the molecular formula C12H16N6S and a molecular weight of 276.37 g/mol. Its IUPAC name is 5-[6-(azepan-1-yl)pyrazin-2-yl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[6-(azepan-1-yl)pyrazin-2-yl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 56689227 |
| Molecular Formula | C12H16N6S |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 5-[6-(azepan-1-yl)pyrazin-2-yl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | S=c1nc(-c2cncc(N3CCCCCC3)n2)[nH][nH]1 |
| InChI | InChI=1S/C12H16N6S/c19-12-15-11(16-17-12)9-7-13-8-10(14-9)18-5-3-1-2-4-6-18/h7-8H,1-6H2,(H2,15,16,17,19) |
| InChIKey | RMAHCUIOBGQEBX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|