About 5-piperidin-1-yl-2H-1,2,4-triazin-3-one
5-piperidin-1-yl-2H-1,2,4-triazin-3-one (PubChem CID 22694033) has the molecular formula C8H12N4O
and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-piperidin-1-yl-2H-1,2,4-triazin-3-one.
Molecular Properties
| Compound Name | 5-piperidin-1-yl-2H-1,2,4-triazin-3-one |
| PubChem CID | 22694033 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 5-piperidin-1-yl-2H-1,2,4-triazin-3-one |
| SMILES | O=c1nc(N2CCCCC2)cn[nH]1 |
| InChI | InChI=1S/C8H12N4O/c13-8-10-7(6-9-11-8)12-4-2-1-3-5-12/h6H,1-5H2,(H,10,11,13) |
| InChIKey | ULLGXNKRJABKPW-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-piperidin-1-yl-2H-1,2,4-triazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-piperidin-1-yl-2H-1,2,4-triazin-3-one?
The IUPAC name of 5-piperidin-1-yl-2H-1,2,4-triazin-3-one (CID 22694033) is 5-piperidin-1-yl-2H-1,2,4-triazin-3-one.
What is the SMILES notation for 5-piperidin-1-yl-2H-1,2,4-triazin-3-one?
The canonical SMILES for 5-piperidin-1-yl-2H-1,2,4-triazin-3-one is O=c1nc(N2CCCCC2)cn[nH]1.
What is the InChIKey of 5-piperidin-1-yl-2H-1,2,4-triazin-3-one?
The InChIKey is ULLGXNKRJABKPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O/c13-8-10-7(6-9-11-8)12-4-2-1-3-5-12/h6H,1-5H2,(H,10,11,13).
What are the key properties of 5-piperidin-1-yl-2H-1,2,4-triazin-3-one?
5-piperidin-1-yl-2H-1,2,4-triazin-3-one has a molecular weight of 180.21 g/mol, XLogP of 0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-piperidin-1-yl-2H-1,2,4-triazin-3-one is sourced from PubChem (CID 22694033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).