C8H12N4O — CID 22694033
5-piperidin-1-yl-2H-1,2,4-triazin-3-one (PubChem CID 22694033) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-piperidin-1-yl-2H-1,2,4-triazin-3-one.
| Compound Name | 5-piperidin-1-yl-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 22694033 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 5-piperidin-1-yl-2H-1,2,4-triazin-3-one |
| SMILES | O=c1nc(N2CCCCC2)cn[nH]1 |
| InChI | InChI=1S/C8H12N4O/c13-8-10-7(6-9-11-8)12-4-2-1-3-5-12/h6H,1-5H2,(H,10,11,13) |
| InChIKey | ULLGXNKRJABKPW-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |