C7H7N7O3 — CID 56695802
1-[3-(4-nitrotriazol-2-yl)-1,2,4-triazol-1-yl]propan-2-one (PubChem CID 56695802) has the molecular formula C7H7N7O3 and a molecular weight of 237.18 g/mol. Its IUPAC name is 1-[3-(4-nitrotriazol-2-yl)-1,2,4-triazol-1-yl]propan-2-one.
| Compound Name | 1-[3-(4-nitrotriazol-2-yl)-1,2,4-triazol-1-yl]propan-2-one |
|---|---|
| PubChem CID | 56695802 |
| Molecular Formula | C7H7N7O3 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 1-[3-(4-nitrotriazol-2-yl)-1,2,4-triazol-1-yl]propan-2-one |
| SMILES | CC(=O)Cn1cnc(-n2ncc([N+](=O)[O-])n2)n1 |
| InChI | InChI=1S/C7H7N7O3/c1-5(15)3-12-4-8-7(11-12)13-9-2-6(10-13)14(16)17/h2,4H,3H2,1H3 |
| InChIKey | OSZDHKVYBIKBJL-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 121.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|