C17H28N4OS — CID 56706732
(2S,4R)-4-amino-N,N-diethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 56706732) has the molecular formula C17H28N4OS and a molecular weight of 336.51 g/mol. Its IUPAC name is (2S,4R)-4-amino-N,N-diethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-amino-N,N-diethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56706732 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (2S,4R)-4-amino-N,N-diethyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1C[C@@H](N)CN1Cc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C17H28N4OS/c1-3-20(4-2)17(22)14-9-12(18)10-21(14)11-16-19-13-7-5-6-8-15(13)23-16/h12,14H,3-11,18H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | GNRDOPVGWIKJHC-OCCSQVGLSA-N |
| XLogP | 1.79 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |