C21H25N5 — CID 56711438
2-(2-methyl-6-piperidin-3-ylpyrimidin-4-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 56711438) has the molecular formula C21H25N5 and a molecular weight of 347.47 g/mol. Its IUPAC name is 2-(2-methyl-6-piperidin-3-ylpyrimidin-4-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 2-(2-methyl-6-piperidin-3-ylpyrimidin-4-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 56711438 |
| Molecular Formula | C21H25N5 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2-(2-methyl-6-piperidin-3-ylpyrimidin-4-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | Cc1nc(C2CCCNC2)cc(N2CCc3[nH]c4ccccc4c3C2)n1 |
| InChI | InChI=1S/C21H25N5/c1-14-23-20(15-5-4-9-22-12-15)11-21(24-14)26-10-8-19-17(13-26)16-6-2-3-7-18(16)25-19/h2-3,6-7,11,15,22,25H,4-5,8-10,12-13H2,1H3 |
| InChIKey | KZFVMDUOZYTTRI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|