C18H20ClN5 — CID 56712173
2-[6-(6-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-methylpyrimidin-4-yl]ethanamine (PubChem CID 56712173) has the molecular formula C18H20ClN5 and a molecular weight of 341.85 g/mol. Its IUPAC name is 2-[6-(6-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-methylpyrimidin-4-yl]ethanamine.
| Compound Name | 2-[6-(6-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-methylpyrimidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 56712173 |
| Molecular Formula | C18H20ClN5 |
| Molecular Weight | 341.85 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-[6-(6-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-methylpyrimidin-4-yl]ethanamine |
| SMILES | Cc1nc(CCN)cc(N2CCc3[nH]c4c(Cl)cccc4c3C2)n1 |
| InChI | InChI=1S/C18H20ClN5/c1-11-21-12(5-7-20)9-17(22-11)24-8-6-16-14(10-24)13-3-2-4-15(19)18(13)23-16/h2-4,9,23H,5-8,10,20H2,1H3 |
| InChIKey | FNGCXBPEQXHBHQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.85 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|