C19H24Cl2N6 — CID 154903375
4-(3-aminocyclobutyl)-6-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrimidin-2-amine;dihydrochloride (PubChem CID 154903375) has the molecular formula C19H24Cl2N6 and a molecular weight of 407.35 g/mol. Its IUPAC name is 4-(3-aminocyclobutyl)-6-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrimidin-2-amine;dihydrochloride.
| Compound Name | 4-(3-aminocyclobutyl)-6-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrimidin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 154903375 |
| Molecular Formula | C19H24Cl2N6 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 4-(3-aminocyclobutyl)-6-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)pyrimidin-2-amine;dihydrochloride |
| SMILES | Cl.Cl.Nc1nc(C2CC(N)C2)cc(N2CCc3c([nH]c4ccccc34)C2)n1 |
| InChI | InChI=1S/C19H22N6.2ClH/c20-12-7-11(8-12)16-9-18(24-19(21)23-16)25-6-5-14-13-3-1-2-4-15(13)22-17(14)10-25;;/h1-4,9,11-12,22H,5-8,10,20H2,(H2,21,23,24);2*1H |
| InChIKey | FBAWZPORXZLUSL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|