C19H26N4O3 — CID 56719551
(2S,4S)-4-amino-1-[2-(2,3-dihydroindol-1-yl)-2-oxoacetyl]-N,N-diethylpyrrolidine-2-carboxamide (PubChem CID 56719551) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is (2S,4S)-4-amino-1-[2-(2,3-dihydroindol-1-yl)-2-oxoacetyl]-N,N-diethylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-amino-1-[2-(2,3-dihydroindol-1-yl)-2-oxoacetyl]-N,N-diethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56719551 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (2S,4S)-4-amino-1-[2-(2,3-dihydroindol-1-yl)-2-oxoacetyl]-N,N-diethylpyrrolidine-2-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1C[C@H](N)CN1C(=O)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H26N4O3/c1-3-21(4-2)17(24)16-11-14(20)12-23(16)19(26)18(25)22-10-9-13-7-5-6-8-15(13)22/h5-8,14,16H,3-4,9-12,20H2,1-2H3/t14-,16-/m0/s1 |
| InChIKey | BUIMEDBQLZCLQY-HOCLYGCPSA-N |
| XLogP | 0.37 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|