C12H18N6O2S — CID 56730240
6-N-(1,1-dioxothiolan-3-yl)-6-N,8,9-trimethylpurine-2,6-diamine (PubChem CID 56730240) has the molecular formula C12H18N6O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 6-N-(1,1-dioxothiolan-3-yl)-6-N,8,9-trimethylpurine-2,6-diamine.
| Compound Name | 6-N-(1,1-dioxothiolan-3-yl)-6-N,8,9-trimethylpurine-2,6-diamine |
|---|---|
| PubChem CID | 56730240 |
| Molecular Formula | C12H18N6O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 6-N-(1,1-dioxothiolan-3-yl)-6-N,8,9-trimethylpurine-2,6-diamine |
| SMILES | Cc1nc2c(N(C)C3CCS(=O)(=O)C3)nc(N)nc2n1C |
| InChI | InChI=1S/C12H18N6O2S/c1-7-14-9-10(17(7)2)15-12(13)16-11(9)18(3)8-4-5-21(19,20)6-8/h8H,4-6H2,1-3H3,(H2,13,15,16) |
| InChIKey | FMKNIFFFKRVRPV-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |