C30H22ClN2O2PS2 — CID 56730312
2-[5-chloro-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-yl]-2-(triphenyl-λ5-phosphanylidene)acetonitrile (PubChem CID 56730312) has the molecular formula C30H22ClN2O2PS2 and a molecular weight of 573.08 g/mol. Its IUPAC name is 2-[5-chloro-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-yl]-2-(triphenyl-λ5-phosphanylidene)acetonitrile.
| Compound Name | 2-[5-chloro-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-yl]-2-(triphenyl-λ5-phosphanylidene)acetonitrile |
|---|---|
| PubChem CID | 56730312 |
| Molecular Formula | C30H22ClN2O2PS2 |
| Molecular Weight | 573.08 g/mol |
| Exact Mass | 572.05 |
| IUPAC Name | 2-[5-chloro-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-yl]-2-(triphenyl-λ5-phosphanylidene)acetonitrile |
| SMILES | Cc1ccc(S(=O)(=O)c2nc(C(C#N)=P(c3ccccc3)(c3ccccc3)c3ccccc3)sc2Cl)cc1 |
| InChI | InChI=1S/C30H22ClN2O2PS2/c1-22-17-19-26(20-18-22)38(34,35)30-28(31)37-29(33-30)27(21-32)36(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20H,1H3 |
| InChIKey | KXHFVQCGUBDXSL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 70.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.08 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|