About N-benzyl-5-(4-chlorophenyl)sulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-amine
N-benzyl-5-(4-chlorophenyl)sulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-amine (PubChem CID 135000474) has the molecular formula C23H19ClN2O4S3
and a molecular weight of 519.07 g/mol. Its IUPAC name is N-benzyl-5-(4-chlorophenyl)sulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-benzyl-5-(4-chlorophenyl)sulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-amine |
| PubChem CID | 135000474 |
| Molecular Formula | C23H19ClN2O4S3 |
| Molecular Weight | 519.07 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | N-benzyl-5-(4-chlorophenyl)sulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(S(=O)(=O)c2nc(NCc3ccccc3)sc2S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H19ClN2O4S3/c1-16-7-11-19(12-8-16)32(27,28)21-22(33(29,30)20-13-9-18(24)10-14-20)31-23(26-21)25-15-17-5-3-2-4-6-17/h2-14H,15H2,1H3,(H,25,26) |
| InChIKey | VSQRVULEKFOVGK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 519.07 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-benzyl-5-(4-chlorophenyl)sulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-5-(4-chlorophenyl)sulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-amine?
The IUPAC name of N-benzyl-5-(4-chlorophenyl)sulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-amine (CID 135000474) is N-benzyl-5-(4-chlorophenyl)sulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-amine.
What is the SMILES notation for N-benzyl-5-(4-chlorophenyl)sulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-amine?
The canonical SMILES for N-benzyl-5-(4-chlorophenyl)sulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-amine is Cc1ccc(S(=O)(=O)c2nc(NCc3ccccc3)sc2S(=O)(=O)c2ccc(Cl)cc2)cc1.
What is the InChIKey of N-benzyl-5-(4-chlorophenyl)sulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-amine?
The InChIKey is VSQRVULEKFOVGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19ClN2O4S3/c1-16-7-11-19(12-8-16)32(27,28)21-22(33(29,30)20-13-9-18(24)10-14-20)31-23(26-21)25-15-17-5-3-2-4-6-17/h2-14H,15H2,1H3,(H,25,26).
What are the key properties of N-benzyl-5-(4-chlorophenyl)sulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-amine?
N-benzyl-5-(4-chlorophenyl)sulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-amine has a molecular weight of 519.07 g/mol, XLogP of 5.38, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-5-(4-chlorophenyl)sulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-2-amine is sourced from PubChem (CID 135000474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).