C11H14O3 — CID 567531
spiro[1,3-dioxolane-2,9'-bicyclo[3.3.1]non-6-ene]-3'-one (PubChem CID 567531) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,9'-bicyclo[3.3.1]non-6-ene]-3'-one.
| Compound Name | spiro[1,3-dioxolane-2,9'-bicyclo[3.3.1]non-6-ene]-3'-one |
|---|---|
| PubChem CID | 567531 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | spiro[1,3-dioxolane-2,9'-bicyclo[3.3.1]non-6-ene]-3'-one |
| SMILES | O=C1CC2C=CCC(C1)C21OCCO1 |
| InChI | InChI=1S/C11H14O3/c12-10-6-8-2-1-3-9(7-10)11(8)13-4-5-14-11/h1-2,8-9H,3-7H2 |
| InChIKey | SHHOPKAKPMOQIT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|