C17H22N4O2 — CID 56754446
N-[2-(2,4-dimethoxyphenyl)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine (PubChem CID 56754446) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[2-(2,4-dimethoxyphenyl)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[2-(2,4-dimethoxyphenyl)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 56754446 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N-[2-(2,4-dimethoxyphenyl)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
| SMILES | COc1ccc(CCNc2ncnc3c2CCNC3)c(OC)c1 |
| InChI | InChI=1S/C17H22N4O2/c1-22-13-4-3-12(16(9-13)23-2)5-8-19-17-14-6-7-18-10-15(14)20-11-21-17/h3-4,9,11,18H,5-8,10H2,1-2H3,(H,19,20,21) |
| InChIKey | QRUJELOCCYIZSX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |