C19H26N4O2 — CID 56753060
N-[1-(3,4-diethoxyphenyl)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine (PubChem CID 56753060) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[1-(3,4-diethoxyphenyl)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[1-(3,4-diethoxyphenyl)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 56753060 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-[1-(3,4-diethoxyphenyl)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CCOc1ccc(C(C)Nc2ncnc3c2CCNC3)cc1OCC |
| InChI | InChI=1S/C19H26N4O2/c1-4-24-17-7-6-14(10-18(17)25-5-2)13(3)23-19-15-8-9-20-11-16(15)21-12-22-19/h6-7,10,12-13,20H,4-5,8-9,11H2,1-3H3,(H,21,22,23) |
| InChIKey | WECOKFXRKXTDRX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |